C19H31N7O9S — CID 176992695
(3R)-15-amino-6-(2-amino-2-oxoethyl)-3-(3-amino-3-oxopropyl)-12-(hydroxymethyl)-9-methyl-5,8,11,14-tetraoxo-1-thia-4,7,10,13-tetrazacyclohexadecane-2-carboxylic acid (PubChem CID 176992695) has the molecular formula C19H31N7O9S and a molecular weight of 533.56 g/mol. Its IUPAC name is (3R)-15-amino-6-(2-amino-2-oxoethyl)-3-(3-amino-3-oxopropyl)-12-(hydroxymethyl)-9-methyl-5,8,11,14-tetraoxo-1-thia-4,7,10,13-tetrazacyclohexadecane-2-carboxylic acid.
| Compound Name | (3R)-15-amino-6-(2-amino-2-oxoethyl)-3-(3-amino-3-oxopropyl)-12-(hydroxymethyl)-9-methyl-5,8,11,14-tetraoxo-1-thia-4,7,10,13-tetrazacyclohexadecane-2-carboxylic acid |
|---|---|
| PubChem CID | 176992695 |
| Molecular Formula | C19H31N7O9S |
| Molecular Weight | 533.56 g/mol |
| Exact Mass | 533.19 |
| IUPAC Name | (3R)-15-amino-6-(2-amino-2-oxoethyl)-3-(3-amino-3-oxopropyl)-12-(hydroxymethyl)-9-methyl-5,8,11,14-tetraoxo-1-thia-4,7,10,13-tetrazacyclohexadecane-2-carboxylic acid |
| SMILES | CC1NC(=O)C(CO)NC(=O)C(N)CSC(C(=O)O)[C@@H](CCC(N)=O)NC(=O)C(CC(N)=O)NC1=O |
| InChI | InChI=1S/C19H31N7O9S/c1-7-15(30)25-10(4-13(22)29)17(32)24-9(2-3-12(21)28)14(19(34)35)36-6-8(20)16(31)26-11(5-27)18(33)23-7/h7-11,14,27H,2-6,20H2,1H3,(H2,21,28)(H2,22,29)(H,23,33)(H,24,32)(H,25,30)(H,26,31)(H,34,35)/t7?,8?,9-,10?,11?,14?/m1/s1 |
| InChIKey | IWWCLWKXJRTDIZ-PEQBFEPKSA-N |
| XLogP | -5.39 |
| TPSA | 286.13 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.56 |
| LogP ≤ 5 | -5.39 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |