C18H30N6O9S — CID 169243961
trans-(6S,9S)-6-(2-amino-2-oxoethyl)-3,12-bis(hydroxymethyl)-9-methyl-15-(methylamino)-5,8,11,14-tetraoxo-1-thia-4,7,10,13-tetrazacyclohexadecane-2-carboxylic acid (PubChem CID 169243961) has the molecular formula C18H30N6O9S and a molecular weight of 506.54 g/mol. Its IUPAC name is trans-(6S,9S)-6-(2-amino-2-oxoethyl)-3,12-bis(hydroxymethyl)-9-methyl-15-(methylamino)-5,8,11,14-tetraoxo-1-thia-4,7,10,13-tetrazacyclohexadecane-2-carboxylic acid.
| Compound Name | trans-(6S,9S)-6-(2-amino-2-oxoethyl)-3,12-bis(hydroxymethyl)-9-methyl-15-(methylamino)-5,8,11,14-tetraoxo-1-thia-4,7,10,13-tetrazacyclohexadecane-2-carboxylic acid |
|---|---|
| PubChem CID | 169243961 |
| Molecular Formula | C18H30N6O9S |
| Molecular Weight | 506.54 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | trans-(6S,9S)-6-(2-amino-2-oxoethyl)-3,12-bis(hydroxymethyl)-9-methyl-15-(methylamino)-5,8,11,14-tetraoxo-1-thia-4,7,10,13-tetrazacyclohexadecane-2-carboxylic acid |
| SMILES | CNC1CSC(C(=O)O)C(CO)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](C)NC(=O)C(CO)NC1=O |
| InChI | InChI=1S/C18H30N6O9S/c1-7-14(28)22-8(3-12(19)27)15(29)23-9(4-25)13(18(32)33)34-6-11(20-2)17(31)24-10(5-26)16(30)21-7/h7-11,13,20,25-26H,3-6H2,1-2H3,(H2,19,27)(H,21,30)(H,22,28)(H,23,29)(H,24,31)(H,32,33)/t7-,8-,9?,10?,11?,13?/m0/s1 |
| InChIKey | LBFAHZQRZQZVDC-OMCARPKJSA-N |
| XLogP | -5.41 |
| TPSA | 249.28 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.54 |
| LogP ≤ 5 | -5.41 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |