C17H28N6O8S2 — CID 176992662
(3R,6S,9S,15R)-15-amino-6-(2-amino-2-oxoethyl)-12-(hydroxymethyl)-9-methyl-5,8,11,14-tetraoxo-3-(sulfanylmethyl)-1-thia-4,7,10,13-tetrazacyclohexadecane-2-carboxylic acid (PubChem CID 176992662) has the molecular formula C17H28N6O8S2 and a molecular weight of 508.58 g/mol. Its IUPAC name is (3R,6S,9S,15R)-15-amino-6-(2-amino-2-oxoethyl)-12-(hydroxymethyl)-9-methyl-5,8,11,14-tetraoxo-3-(sulfanylmethyl)-1-thia-4,7,10,13-tetrazacyclohexadecane-2-carboxylic acid.
| Compound Name | (3R,6S,9S,15R)-15-amino-6-(2-amino-2-oxoethyl)-12-(hydroxymethyl)-9-methyl-5,8,11,14-tetraoxo-3-(sulfanylmethyl)-1-thia-4,7,10,13-tetrazacyclohexadecane-2-carboxylic acid |
|---|---|
| PubChem CID | 176992662 |
| Molecular Formula | C17H28N6O8S2 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | (3R,6S,9S,15R)-15-amino-6-(2-amino-2-oxoethyl)-12-(hydroxymethyl)-9-methyl-5,8,11,14-tetraoxo-3-(sulfanylmethyl)-1-thia-4,7,10,13-tetrazacyclohexadecane-2-carboxylic acid |
| SMILES | C[C@@H]1NC(=O)C(CO)NC(=O)[C@@H](N)CSC(C(=O)O)[C@@H](CS)NC(=O)[C@H](CC(N)=O)NC1=O |
| InChI | InChI=1S/C17H28N6O8S2/c1-6-13(26)21-8(2-11(19)25)15(28)23-10(4-32)12(17(30)31)33-5-7(18)14(27)22-9(3-24)16(29)20-6/h6-10,12,24,32H,2-5,18H2,1H3,(H2,19,25)(H,20,29)(H,21,26)(H,22,27)(H,23,28)(H,30,31)/t6-,7-,8-,9?,10+,12?/m0/s1 |
| InChIKey | ILKDQHDKARXRCR-UGTXMUOMSA-N |
| XLogP | -4.73 |
| TPSA | 243.04 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | -4.73 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|