C21H37N7O8S — CID 169243930
trans-(9S,15R)-3-(4-aminobutyl)-6-(2-amino-2-oxoethyl)-12-(hydroxymethyl)-9-methyl-15-(methylamino)-5,8,11,14-tetraoxo-1-thia-4,7,10,13-tetrazacyclohexadecane-2-carboxylic acid (PubChem CID 169243930) has the molecular formula C21H37N7O8S and a molecular weight of 547.64 g/mol. Its IUPAC name is trans-(9S,15R)-3-(4-aminobutyl)-6-(2-amino-2-oxoethyl)-12-(hydroxymethyl)-9-methyl-15-(methylamino)-5,8,11,14-tetraoxo-1-thia-4,7,10,13-tetrazacyclohexadecane-2-carboxylic acid.
| Compound Name | trans-(9S,15R)-3-(4-aminobutyl)-6-(2-amino-2-oxoethyl)-12-(hydroxymethyl)-9-methyl-15-(methylamino)-5,8,11,14-tetraoxo-1-thia-4,7,10,13-tetrazacyclohexadecane-2-carboxylic acid |
|---|---|
| PubChem CID | 169243930 |
| Molecular Formula | C21H37N7O8S |
| Molecular Weight | 547.64 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | trans-(9S,15R)-3-(4-aminobutyl)-6-(2-amino-2-oxoethyl)-12-(hydroxymethyl)-9-methyl-15-(methylamino)-5,8,11,14-tetraoxo-1-thia-4,7,10,13-tetrazacyclohexadecane-2-carboxylic acid |
| SMILES | CN[C@H]1CSC(C(=O)O)C(CCCCN)NC(=O)C(CC(N)=O)NC(=O)[C@H](C)NC(=O)C(CO)NC1=O |
| InChI | InChI=1S/C21H37N7O8S/c1-10-17(31)27-12(7-15(23)30)18(32)26-11(5-3-4-6-22)16(21(35)36)37-9-14(24-2)20(34)28-13(8-29)19(33)25-10/h10-14,16,24,29H,3-9,22H2,1-2H3,(H2,23,30)(H,25,33)(H,26,32)(H,27,31)(H,28,34)(H,35,36)/t10-,11?,12?,13?,14-,16?/m0/s1 |
| InChIKey | GFGRCTSPYHWXGN-JWKOKLOCSA-N |
| XLogP | -4.27 |
| TPSA | 255.07 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.64 |
| LogP ≤ 5 | -4.27 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|