C18H34N6O4 — CID 102389498
(3S,6R,9S,12R)-3,9-bis(4-aminobutyl)-6,12-dimethyl-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone (PubChem CID 102389498) has the molecular formula C18H34N6O4 and a molecular weight of 398.51 g/mol. Its IUPAC name is (3S,6R,9S,12R)-3,9-bis(4-aminobutyl)-6,12-dimethyl-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone.
| Compound Name | (3S,6R,9S,12R)-3,9-bis(4-aminobutyl)-6,12-dimethyl-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 102389498 |
| Molecular Formula | C18H34N6O4 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | (3S,6R,9S,12R)-3,9-bis(4-aminobutyl)-6,12-dimethyl-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone |
| SMILES | C[C@H]1NC(=O)[C@H](CCCCN)NC(=O)[C@@H](C)NC(=O)[C@H](CCCCN)NC1=O |
| InChI | InChI=1S/C18H34N6O4/c1-11-15(25)23-14(8-4-6-10-20)18(28)22-12(2)16(26)24-13(17(27)21-11)7-3-5-9-19/h11-14H,3-10,19-20H2,1-2H3,(H,21,27)(H,22,28)(H,23,25)(H,24,26)/t11-,12-,13+,14+/m1/s1 |
| InChIKey | PQJDPFWHXIFOFN-MQYQWHSLSA-N |
| XLogP | -1.76 |
| TPSA | 168.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|