C11H19N3O4 — CID 12071938
3-[(2S,5S)-5-(4-aminobutyl)-3,6-dioxopiperazin-2-yl]propanoic acid (PubChem CID 12071938) has the molecular formula C11H19N3O4 and a molecular weight of 257.29 g/mol. Its IUPAC name is 3-[(2S,5S)-5-(4-aminobutyl)-3,6-dioxopiperazin-2-yl]propanoic acid.
| Compound Name | 3-[(2S,5S)-5-(4-aminobutyl)-3,6-dioxopiperazin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 12071938 |
| Molecular Formula | C11H19N3O4 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 3-[(2S,5S)-5-(4-aminobutyl)-3,6-dioxopiperazin-2-yl]propanoic acid |
| SMILES | NCCCC[C@@H]1NC(=O)[C@H](CCC(=O)O)NC1=O |
| InChI | InChI=1S/C11H19N3O4/c12-6-2-1-3-7-10(17)14-8(11(18)13-7)4-5-9(15)16/h7-8H,1-6,12H2,(H,13,18)(H,14,17)(H,15,16)/t7-,8-/m0/s1 |
| InChIKey | RQYALSYYBPOTFA-YUMQZZPRSA-N |
| XLogP | -1.04 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|