C12H26Cl2N4O2 — CID 175673132
(3S,6S)-3,6-bis(4-aminobutyl)piperazine-2,5-dione;dihydrochloride (PubChem CID 175673132) has the molecular formula C12H26Cl2N4O2 and a molecular weight of 329.27 g/mol. Its IUPAC name is (3S,6S)-3,6-bis(4-aminobutyl)piperazine-2,5-dione;dihydrochloride.
| Compound Name | (3S,6S)-3,6-bis(4-aminobutyl)piperazine-2,5-dione;dihydrochloride |
|---|---|
| PubChem CID | 175673132 |
| Molecular Formula | C12H26Cl2N4O2 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (3S,6S)-3,6-bis(4-aminobutyl)piperazine-2,5-dione;dihydrochloride |
| SMILES | Cl.Cl.NCCCC[C@@H]1NC(=O)[C@H](CCCCN)NC1=O |
| InChI | InChI=1S/C12H24N4O2.2ClH/c13-7-3-1-5-9-11(17)16-10(12(18)15-9)6-2-4-8-14;;/h9-10H,1-8,13-14H2,(H,15,18)(H,16,17);2*1H/t9-,10-;;/m0../s1 |
| InChIKey | YTCZRLISNWQEPT-BZDVOYDHSA-N |
| XLogP | 0.07 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|