C10H16I2N2O2 — CID 89339167
3,6-bis(3-iodopropyl)piperazine-2,5-dione (PubChem CID 89339167) has the molecular formula C10H16I2N2O2 and a molecular weight of 450.06 g/mol. Its IUPAC name is 3,6-bis(3-iodopropyl)piperazine-2,5-dione.
| Compound Name | 3,6-bis(3-iodopropyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 89339167 |
| Molecular Formula | C10H16I2N2O2 |
| Molecular Weight | 450.06 g/mol |
| Exact Mass | 449.93 |
| IUPAC Name | 3,6-bis(3-iodopropyl)piperazine-2,5-dione |
| SMILES | O=C1NC(CCCI)C(=O)NC1CCCI |
| InChI | InChI=1S/C10H16I2N2O2/c11-5-1-3-7-9(15)14-8(4-2-6-12)10(16)13-7/h7-8H,1-6H2,(H,13,16)(H,14,15) |
| InChIKey | GSSXIWPZMVDSAK-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.06 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|