C10H18N2O3 — CID 142043991
3-(4-methoxybutyl)-6-methylpiperazine-2,5-dione (PubChem CID 142043991) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is 3-(4-methoxybutyl)-6-methylpiperazine-2,5-dione.
| Compound Name | 3-(4-methoxybutyl)-6-methylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 142043991 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 3-(4-methoxybutyl)-6-methylpiperazine-2,5-dione |
| SMILES | COCCCCC1NC(=O)C(C)NC1=O |
| InChI | InChI=1S/C10H18N2O3/c1-7-9(13)12-8(10(14)11-7)5-3-4-6-15-2/h7-8H,3-6H2,1-2H3,(H,11,14)(H,12,13) |
| InChIKey | MOBHJFCUJNXWOU-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|