C12H21N3O3 — CID 121016149
N-[4-(5-ethyl-3,6-dioxopiperazin-2-yl)butyl]acetamide (PubChem CID 121016149) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is N-[4-(5-ethyl-3,6-dioxopiperazin-2-yl)butyl]acetamide.
| Compound Name | N-[4-(5-ethyl-3,6-dioxopiperazin-2-yl)butyl]acetamide |
|---|---|
| PubChem CID | 121016149 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | N-[4-(5-ethyl-3,6-dioxopiperazin-2-yl)butyl]acetamide |
| SMILES | CCC1NC(=O)C(CCCCNC(C)=O)NC1=O |
| InChI | InChI=1S/C12H21N3O3/c1-3-9-11(17)15-10(12(18)14-9)6-4-5-7-13-8(2)16/h9-10H,3-7H2,1-2H3,(H,13,16)(H,14,18)(H,15,17) |
| InChIKey | GKWZKDPWOVVAFN-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|