C19H24N4O3 — CID 54514745
N-[3-[(2R,5R)-5-[1-(1H-indol-3-yl)ethyl]-3,6-dioxopiperazin-2-yl]propyl]acetamide (PubChem CID 54514745) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is N-[3-[(2R,5R)-5-[1-(1H-indol-3-yl)ethyl]-3,6-dioxopiperazin-2-yl]propyl]acetamide.
| Compound Name | N-[3-[(2R,5R)-5-[1-(1H-indol-3-yl)ethyl]-3,6-dioxopiperazin-2-yl]propyl]acetamide |
|---|---|
| PubChem CID | 54514745 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | N-[3-[(2R,5R)-5-[1-(1H-indol-3-yl)ethyl]-3,6-dioxopiperazin-2-yl]propyl]acetamide |
| SMILES | CC(=O)NCCC[C@H]1NC(=O)[C@@H](C(C)c2c[nH]c3ccccc23)NC1=O |
| InChI | InChI=1S/C19H24N4O3/c1-11(14-10-21-15-7-4-3-6-13(14)15)17-19(26)22-16(18(25)23-17)8-5-9-20-12(2)24/h3-4,6-7,10-11,16-17,21H,5,8-9H2,1-2H3,(H,20,24)(H,22,26)(H,23,25)/t11?,16-,17-/m1/s1 |
| InChIKey | YLQFJCLLDFKHEU-YSGDOOFJSA-N |
| XLogP | 1.17 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|