C17H19N3O4 — CID 54209829
3-[(2R,5R)-5-[1-(1H-indol-3-yl)ethyl]-3,6-dioxopiperazin-2-yl]propanoic acid (PubChem CID 54209829) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is 3-[(2R,5R)-5-[1-(1H-indol-3-yl)ethyl]-3,6-dioxopiperazin-2-yl]propanoic acid.
| Compound Name | 3-[(2R,5R)-5-[1-(1H-indol-3-yl)ethyl]-3,6-dioxopiperazin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 54209829 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 3-[(2R,5R)-5-[1-(1H-indol-3-yl)ethyl]-3,6-dioxopiperazin-2-yl]propanoic acid |
| SMILES | CC(c1c[nH]c2ccccc12)[C@H]1NC(=O)[C@@H](CCC(=O)O)NC1=O |
| InChI | InChI=1S/C17H19N3O4/c1-9(11-8-18-12-5-3-2-4-10(11)12)15-17(24)19-13(16(23)20-15)6-7-14(21)22/h2-5,8-9,13,15,18H,6-7H2,1H3,(H,19,24)(H,20,23)(H,21,22)/t9?,13-,15-/m1/s1 |
| InChIKey | PVDZFHFYICFMPC-IVQNAXQPSA-N |
| XLogP | 1.12 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |