C16H20N4O2 — CID 132562847
(3S,6R)-3-(4-aminobutyl)-6-(1H-indol-3-yl)piperazine-2,5-dione (PubChem CID 132562847) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is (3S,6R)-3-(4-aminobutyl)-6-(1H-indol-3-yl)piperazine-2,5-dione.
| Compound Name | (3S,6R)-3-(4-aminobutyl)-6-(1H-indol-3-yl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 132562847 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | (3S,6R)-3-(4-aminobutyl)-6-(1H-indol-3-yl)piperazine-2,5-dione |
| SMILES | NCCCC[C@@H]1NC(=O)[C@@H](c2c[nH]c3ccccc23)NC1=O |
| InChI | InChI=1S/C16H20N4O2/c17-8-4-3-7-13-15(21)20-14(16(22)19-13)11-9-18-12-6-2-1-5-10(11)12/h1-2,5-6,9,13-14,18H,3-4,7-8,17H2,(H,19,22)(H,20,21)/t13-,14+/m0/s1 |
| InChIKey | KKUGLCNPIMLAPF-UONOGXRCSA-N |
| XLogP | 0.95 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|