C16H26N6O8S2 — CID 176992657
(2S,5S,8S,14R)-14-amino-5-(2-amino-2-oxoethyl)-11-(hydroxymethyl)-8-methyl-4,7,10,13-tetraoxo-2-(sulfanylmethyl)-1-thia-3,6,9,12-tetrazacyclopentadecane-2-carboxylic acid (PubChem CID 176992657) has the molecular formula C16H26N6O8S2 and a molecular weight of 494.55 g/mol. Its IUPAC name is (2S,5S,8S,14R)-14-amino-5-(2-amino-2-oxoethyl)-11-(hydroxymethyl)-8-methyl-4,7,10,13-tetraoxo-2-(sulfanylmethyl)-1-thia-3,6,9,12-tetrazacyclopentadecane-2-carboxylic acid.
| Compound Name | (2S,5S,8S,14R)-14-amino-5-(2-amino-2-oxoethyl)-11-(hydroxymethyl)-8-methyl-4,7,10,13-tetraoxo-2-(sulfanylmethyl)-1-thia-3,6,9,12-tetrazacyclopentadecane-2-carboxylic acid |
|---|---|
| PubChem CID | 176992657 |
| Molecular Formula | C16H26N6O8S2 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | (2S,5S,8S,14R)-14-amino-5-(2-amino-2-oxoethyl)-11-(hydroxymethyl)-8-methyl-4,7,10,13-tetraoxo-2-(sulfanylmethyl)-1-thia-3,6,9,12-tetrazacyclopentadecane-2-carboxylic acid |
| SMILES | C[C@@H]1NC(=O)C(CO)NC(=O)[C@@H](N)CS[C@](CS)(C(=O)O)NC(=O)[C@H](CC(N)=O)NC1=O |
| InChI | InChI=1S/C16H26N6O8S2/c1-6-11(25)20-8(2-10(18)24)14(28)22-16(5-31,15(29)30)32-4-7(17)12(26)21-9(3-23)13(27)19-6/h6-9,23,31H,2-5,17H2,1H3,(H2,18,24)(H,19,27)(H,20,25)(H,21,26)(H,22,28)(H,29,30)/t6-,7-,8-,9?,16+/m0/s1 |
| InChIKey | SYCXMZMXYCUPGQ-MKKHINPLSA-N |
| XLogP | -4.77 |
| TPSA | 243.04 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | -4.77 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|