C15H28N4O3 — CID 177167010
2-[(5R)-5-(3-aminopropyl)-3,6-dioxopiperazin-2-yl]-N-(4-methylpentyl)acetamide (PubChem CID 177167010) has the molecular formula C15H28N4O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is 2-[(5R)-5-(3-aminopropyl)-3,6-dioxopiperazin-2-yl]-N-(4-methylpentyl)acetamide.
| Compound Name | 2-[(5R)-5-(3-aminopropyl)-3,6-dioxopiperazin-2-yl]-N-(4-methylpentyl)acetamide |
|---|---|
| PubChem CID | 177167010 |
| Molecular Formula | C15H28N4O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | 2-[(5R)-5-(3-aminopropyl)-3,6-dioxopiperazin-2-yl]-N-(4-methylpentyl)acetamide |
| SMILES | CC(C)CCCNC(=O)CC1NC(=O)[C@@H](CCCN)NC1=O |
| InChI | InChI=1S/C15H28N4O3/c1-10(2)5-4-8-17-13(20)9-12-15(22)18-11(6-3-7-16)14(21)19-12/h10-12H,3-9,16H2,1-2H3,(H,17,20)(H,18,22)(H,19,21)/t11-,12?/m1/s1 |
| InChIKey | SMVFIPKYGWPFJD-JHJMLUEUSA-N |
| XLogP | -0.35 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|