C31H54N8O10 — CID 171639440
2-[4,7-bis(carboxymethyl)-10-[2-[3-[(2R,5R)-5-[2-(hexylamino)-2-oxoethyl]-3,6-dioxopiperazin-2-yl]propylamino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 171639440) has the molecular formula C31H54N8O10 and a molecular weight of 698.82 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-10-[2-[3-[(2R,5R)-5-[2-(hexylamino)-2-oxoethyl]-3,6-dioxopiperazin-2-yl]propylamino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-10-[2-[3-[(2R,5R)-5-[2-(hexylamino)-2-oxoethyl]-3,6-dioxopiperazin-2-yl]propylamino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 171639440 |
| Molecular Formula | C31H54N8O10 |
| Molecular Weight | 698.82 g/mol |
| Exact Mass | 698.40 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-10-[2-[3-[(2R,5R)-5-[2-(hexylamino)-2-oxoethyl]-3,6-dioxopiperazin-2-yl]propylamino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CCCCCCNC(=O)C[C@H]1NC(=O)[C@@H](CCCNC(=O)CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)NC1=O |
| InChI | InChI=1S/C31H54N8O10/c1-2-3-4-5-8-32-25(40)18-24-31(49)34-23(30(48)35-24)7-6-9-33-26(41)19-36-10-12-37(20-27(42)43)14-16-39(22-29(46)47)17-15-38(13-11-36)21-28(44)45/h23-24H,2-22H2,1H3,(H,32,40)(H,33,41)(H,34,49)(H,35,48)(H,42,43)(H,44,45)(H,46,47)/t23-,24-/m1/s1 |
| InChIKey | MBQMXWHDINMWOJ-DNQXCXABSA-N |
| XLogP | -2.57 |
| TPSA | 241.26 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.82 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|