C34H62N8O9 — CID 177167125
2-[4,10-bis(carboxymethyl)-7-[2-oxo-1-[[1-[2-oxo-2-[[6-oxo-6-(pentylamino)hexyl]amino]ethyl]piperidin-4-yl]amino]ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 177167125) has the molecular formula C34H62N8O9 and a molecular weight of 726.92 g/mol. Its IUPAC name is 2-[4,10-bis(carboxymethyl)-7-[2-oxo-1-[[1-[2-oxo-2-[[6-oxo-6-(pentylamino)hexyl]amino]ethyl]piperidin-4-yl]amino]ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,10-bis(carboxymethyl)-7-[2-oxo-1-[[1-[2-oxo-2-[[6-oxo-6-(pentylamino)hexyl]amino]ethyl]piperidin-4-yl]amino]ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 177167125 |
| Molecular Formula | C34H62N8O9 |
| Molecular Weight | 726.92 g/mol |
| Exact Mass | 726.46 |
| IUPAC Name | 2-[4,10-bis(carboxymethyl)-7-[2-oxo-1-[[1-[2-oxo-2-[[6-oxo-6-(pentylamino)hexyl]amino]ethyl]piperidin-4-yl]amino]ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CCCCCNC(=O)CCCCCNC(=O)CN1CCC(NC(C=O)N2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)CC1 |
| InChI | InChI=1S/C34H62N8O9/c1-2-3-6-11-35-30(44)8-5-4-7-12-36-31(45)23-38-13-9-28(10-14-38)37-29(27-43)42-21-19-40(25-33(48)49)17-15-39(24-32(46)47)16-18-41(20-22-42)26-34(50)51/h27-29,37H,2-26H2,1H3,(H,35,44)(H,36,45)(H,46,47)(H,48,49)(H,50,51) |
| InChIKey | IURQDLPXUVKUHB-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 215.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.92 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|