C39H75N9O6 — CID 59409059
6-amino-N-[4-[6,10-bis[4-(6-aminohexanoylamino)butyl]-4,8,12-trioxo-1,5,9-triazacyclododec-2-yl]butyl]hexanamide (PubChem CID 59409059) has the molecular formula C39H75N9O6 and a molecular weight of 766.09 g/mol. Its IUPAC name is 6-amino-N-[4-[6,10-bis[4-(6-aminohexanoylamino)butyl]-4,8,12-trioxo-1,5,9-triazacyclododec-2-yl]butyl]hexanamide.
| Compound Name | 6-amino-N-[4-[6,10-bis[4-(6-aminohexanoylamino)butyl]-4,8,12-trioxo-1,5,9-triazacyclododec-2-yl]butyl]hexanamide |
|---|---|
| PubChem CID | 59409059 |
| Molecular Formula | C39H75N9O6 |
| Molecular Weight | 766.09 g/mol |
| Exact Mass | 765.58 |
| IUPAC Name | 6-amino-N-[4-[6,10-bis[4-(6-aminohexanoylamino)butyl]-4,8,12-trioxo-1,5,9-triazacyclododec-2-yl]butyl]hexanamide |
| SMILES | NCCCCCC(=O)NCCCCC1CC(=O)NC(CCCCNC(=O)CCCCCN)CC(=O)NC(CCCCNC(=O)CCCCCN)CC(=O)N1 |
| InChI | InChI=1S/C39H75N9O6/c40-22-10-1-4-19-34(49)43-25-13-7-16-31-28-37(52)47-33(18-9-15-27-45-36(51)21-6-3-12-24-42)30-39(54)48-32(29-38(53)46-31)17-8-14-26-44-35(50)20-5-2-11-23-41/h31-33H,1-30,40-42H2,(H,43,49)(H,44,50)(H,45,51)(H,46,53)(H,47,52)(H,48,54) |
| InChIKey | XNHMMMPSZVIKLV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 252.66 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.09 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|