C32H41N7O7 — CID 146116289
N-[4-[11-[(1-benzyltriazol-4-yl)methyl]-6,9,12-trioxo-1,4-dioxa-7,10,13-triazacyclopentadec-8-yl]butyl]-2-phenoxyacetamide (PubChem CID 146116289) has the molecular formula C32H41N7O7 and a molecular weight of 635.72 g/mol. Its IUPAC name is N-[4-[11-[(1-benzyltriazol-4-yl)methyl]-6,9,12-trioxo-1,4-dioxa-7,10,13-triazacyclopentadec-8-yl]butyl]-2-phenoxyacetamide.
| Compound Name | N-[4-[11-[(1-benzyltriazol-4-yl)methyl]-6,9,12-trioxo-1,4-dioxa-7,10,13-triazacyclopentadec-8-yl]butyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 146116289 |
| Molecular Formula | C32H41N7O7 |
| Molecular Weight | 635.72 g/mol |
| Exact Mass | 635.31 |
| IUPAC Name | N-[4-[11-[(1-benzyltriazol-4-yl)methyl]-6,9,12-trioxo-1,4-dioxa-7,10,13-triazacyclopentadec-8-yl]butyl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)NCCCCC1NC(=O)COCCOCCNC(=O)C(Cc2cn(Cc3ccccc3)nn2)NC1=O |
| InChI | InChI=1S/C32H41N7O7/c40-29(23-46-26-11-5-2-6-12-26)33-14-8-7-13-27-32(43)36-28(31(42)34-15-16-44-17-18-45-22-30(41)35-27)19-25-21-39(38-37-25)20-24-9-3-1-4-10-24/h1-6,9-12,21,27-28H,7-8,13-20,22-23H2,(H,33,40)(H,34,42)(H,35,41)(H,36,43) |
| InChIKey | VDHPTEWOVNYJHJ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 174.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.72 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|