C33H43N7O7S — CID 146116717
18-[(1-benzyltriazol-4-yl)methyl]-3-[(4-methylsulfonylphenyl)methyl]-10,13-dioxa-3,7,16,19-tetrazaspiro[5.15]henicosane-8,17,20-trione (PubChem CID 146116717) has the molecular formula C33H43N7O7S and a molecular weight of 681.82 g/mol. Its IUPAC name is 18-[(1-benzyltriazol-4-yl)methyl]-3-[(4-methylsulfonylphenyl)methyl]-10,13-dioxa-3,7,16,19-tetrazaspiro[5.15]henicosane-8,17,20-trione.
| Compound Name | 18-[(1-benzyltriazol-4-yl)methyl]-3-[(4-methylsulfonylphenyl)methyl]-10,13-dioxa-3,7,16,19-tetrazaspiro[5.15]henicosane-8,17,20-trione |
|---|---|
| PubChem CID | 146116717 |
| Molecular Formula | C33H43N7O7S |
| Molecular Weight | 681.82 g/mol |
| Exact Mass | 681.29 |
| IUPAC Name | 18-[(1-benzyltriazol-4-yl)methyl]-3-[(4-methylsulfonylphenyl)methyl]-10,13-dioxa-3,7,16,19-tetrazaspiro[5.15]henicosane-8,17,20-trione |
| SMILES | CS(=O)(=O)c1ccc(CN2CCC3(CC2)CC(=O)NC(Cc2cn(Cc4ccccc4)nn2)C(=O)NCCOCCOCC(=O)N3)cc1 |
| InChI | InChI=1S/C33H43N7O7S/c1-48(44,45)28-9-7-26(8-10-28)21-39-14-11-33(12-15-39)20-30(41)35-29(32(43)34-13-16-46-17-18-47-24-31(42)36-33)19-27-23-40(38-37-27)22-25-5-3-2-4-6-25/h2-10,23,29H,11-22,24H2,1H3,(H,34,43)(H,35,41)(H,36,42) |
| InChIKey | QGEQJHYDOGLGGH-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 173.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.82 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |