C29H36N8O4 — CID 154813670
(5R)-9-[2-(oxan-4-ylamino)ethyl]-5-[[1-(pyridin-3-ylmethyl)triazol-4-yl]methyl]-3,6,9-triazabicyclo[10.4.0]hexadeca-1(16),12,14-triene-4,7,10-trione (PubChem CID 154813670) has the molecular formula C29H36N8O4 and a molecular weight of 560.66 g/mol. Its IUPAC name is (5R)-9-[2-(oxan-4-ylamino)ethyl]-5-[[1-(pyridin-3-ylmethyl)triazol-4-yl]methyl]-3,6,9-triazabicyclo[10.4.0]hexadeca-1(16),12,14-triene-4,7,10-trione.
| Compound Name | (5R)-9-[2-(oxan-4-ylamino)ethyl]-5-[[1-(pyridin-3-ylmethyl)triazol-4-yl]methyl]-3,6,9-triazabicyclo[10.4.0]hexadeca-1(16),12,14-triene-4,7,10-trione |
|---|---|
| PubChem CID | 154813670 |
| Molecular Formula | C29H36N8O4 |
| Molecular Weight | 560.66 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | (5R)-9-[2-(oxan-4-ylamino)ethyl]-5-[[1-(pyridin-3-ylmethyl)triazol-4-yl]methyl]-3,6,9-triazabicyclo[10.4.0]hexadeca-1(16),12,14-triene-4,7,10-trione |
| SMILES | O=C1CN(CCNC2CCOCC2)C(=O)Cc2ccccc2CNC(=O)[C@@H](Cc2cn(Cc3cccnc3)nn2)N1 |
| InChI | InChI=1S/C29H36N8O4/c38-27-20-36(11-10-31-24-7-12-41-13-8-24)28(39)14-22-5-1-2-6-23(22)17-32-29(40)26(33-27)15-25-19-37(35-34-25)18-21-4-3-9-30-16-21/h1-6,9,16,19,24,26,31H,7-8,10-15,17-18,20H2,(H,32,40)(H,33,38)/t26-/m1/s1 |
| InChIKey | POEVRSMTAOSTMK-AREMUKBSSA-N |
| XLogP | 0.22 |
| TPSA | 143.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.66 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |