C27H36FN7O7 — CID 154813668
(1R,5R,12S)-5-[[1-(4-fluorophenyl)triazol-4-yl]methyl]-13,14-dihydroxy-9-[2-(oxan-4-ylamino)ethyl]-15-oxa-3,6,9-triazabicyclo[10.2.1]pentadecane-4,7,10-trione (PubChem CID 154813668) has the molecular formula C27H36FN7O7 and a molecular weight of 589.63 g/mol. Its IUPAC name is (1R,5R,12S)-5-[[1-(4-fluorophenyl)triazol-4-yl]methyl]-13,14-dihydroxy-9-[2-(oxan-4-ylamino)ethyl]-15-oxa-3,6,9-triazabicyclo[10.2.1]pentadecane-4,7,10-trione.
| Compound Name | (1R,5R,12S)-5-[[1-(4-fluorophenyl)triazol-4-yl]methyl]-13,14-dihydroxy-9-[2-(oxan-4-ylamino)ethyl]-15-oxa-3,6,9-triazabicyclo[10.2.1]pentadecane-4,7,10-trione |
|---|---|
| PubChem CID | 154813668 |
| Molecular Formula | C27H36FN7O7 |
| Molecular Weight | 589.63 g/mol |
| Exact Mass | 589.27 |
| IUPAC Name | (1R,5R,12S)-5-[[1-(4-fluorophenyl)triazol-4-yl]methyl]-13,14-dihydroxy-9-[2-(oxan-4-ylamino)ethyl]-15-oxa-3,6,9-triazabicyclo[10.2.1]pentadecane-4,7,10-trione |
| SMILES | O=C1CN(CCNC2CCOCC2)C(=O)C[C@@H]2O[C@H](CNC(=O)[C@@H](Cc3cn(-c4ccc(F)cc4)nn3)N1)C(O)C2O |
| InChI | InChI=1S/C27H36FN7O7/c28-16-1-3-19(4-2-16)35-14-18(32-33-35)11-20-27(40)30-13-22-26(39)25(38)21(42-22)12-24(37)34(15-23(36)31-20)8-7-29-17-5-9-41-10-6-17/h1-4,14,17,20-22,25-26,29,38-39H,5-13,15H2,(H,30,40)(H,31,36)/t20-,21+,22-,25?,26?/m1/s1 |
| InChIKey | SATXYEAWAVQIKO-XZAXVHJQSA-N |
| XLogP | -1.96 |
| TPSA | 180.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.63 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |