C14H18N4O2 — CID 63099867
3-[2-(oxan-4-ylamino)ethyl]-1,2,3-benzotriazin-4-one (PubChem CID 63099867) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-[2-(oxan-4-ylamino)ethyl]-1,2,3-benzotriazin-4-one.
| Compound Name | 3-[2-(oxan-4-ylamino)ethyl]-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 63099867 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 3-[2-(oxan-4-ylamino)ethyl]-1,2,3-benzotriazin-4-one |
| SMILES | O=c1c2ccccc2nnn1CCNC1CCOCC1 |
| InChI | InChI=1S/C14H18N4O2/c19-14-12-3-1-2-4-13(12)16-17-18(14)8-7-15-11-5-9-20-10-6-11/h1-4,11,15H,5-10H2 |
| InChIKey | VUOXBMGKDWCWOC-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |