C12H13N3O3 — CID 97317007
3-[[(4R)-1,3-dioxan-4-yl]methyl]-1,2,3-benzotriazin-4-one (PubChem CID 97317007) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is 3-[[(4R)-1,3-dioxan-4-yl]methyl]-1,2,3-benzotriazin-4-one.
| Compound Name | 3-[[(4R)-1,3-dioxan-4-yl]methyl]-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 97317007 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 3-[[(4R)-1,3-dioxan-4-yl]methyl]-1,2,3-benzotriazin-4-one |
| SMILES | O=c1c2ccccc2nnn1C[C@H]1CCOCO1 |
| InChI | InChI=1S/C12H13N3O3/c16-12-10-3-1-2-4-11(10)13-14-15(12)7-9-5-6-17-8-18-9/h1-4,9H,5-8H2/t9-/m1/s1 |
| InChIKey | TZODLHSMDILPCK-SECBINFHSA-N |
| XLogP | 0.55 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |