C16H24N4O — CID 62566724
3-[2-(heptan-2-ylamino)ethyl]-1,2,3-benzotriazin-4-one (PubChem CID 62566724) has the molecular formula C16H24N4O and a molecular weight of 288.39 g/mol. Its IUPAC name is 3-[2-(heptan-2-ylamino)ethyl]-1,2,3-benzotriazin-4-one.
| Compound Name | 3-[2-(heptan-2-ylamino)ethyl]-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 62566724 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 3-[2-(heptan-2-ylamino)ethyl]-1,2,3-benzotriazin-4-one |
| SMILES | CCCCCC(C)NCCn1nnc2ccccc2c1=O |
| InChI | InChI=1S/C16H24N4O/c1-3-4-5-8-13(2)17-11-12-20-16(21)14-9-6-7-10-15(14)18-19-20/h6-7,9-10,13,17H,3-5,8,11-12H2,1-2H3 |
| InChIKey | PTQZWELOHGSITK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|