C16H17N5O3 — CID 60501411
2-cyano-3-oxo-5-(4-oxo-1,2,3-benzotriazin-3-yl)-N-propylpentanamide (PubChem CID 60501411) has the molecular formula C16H17N5O3 and a molecular weight of 327.34 g/mol. Its IUPAC name is 2-cyano-3-oxo-5-(4-oxo-1,2,3-benzotriazin-3-yl)-N-propylpentanamide.
| Compound Name | 2-cyano-3-oxo-5-(4-oxo-1,2,3-benzotriazin-3-yl)-N-propylpentanamide |
|---|---|
| PubChem CID | 60501411 |
| Molecular Formula | C16H17N5O3 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 2-cyano-3-oxo-5-(4-oxo-1,2,3-benzotriazin-3-yl)-N-propylpentanamide |
| SMILES | CCCNC(=O)C(C#N)C(=O)CCn1nnc2ccccc2c1=O |
| InChI | InChI=1S/C16H17N5O3/c1-2-8-18-15(23)12(10-17)14(22)7-9-21-16(24)11-5-3-4-6-13(11)19-20-21/h3-6,12H,2,7-9H2,1H3,(H,18,23) |
| InChIKey | SQVPSDOORAAESV-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|