C27H37N7O8 — CID 154813662
(1R,5R,12S)-13,14-dihydroxy-5-[[1-(4-hydroxyphenyl)triazol-4-yl]methyl]-9-[2-(oxan-4-ylamino)ethyl]-15-oxa-3,6,9-triazabicyclo[10.2.1]pentadecane-4,7,10-trione (PubChem CID 154813662) has the molecular formula C27H37N7O8 and a molecular weight of 587.63 g/mol. Its IUPAC name is (1R,5R,12S)-13,14-dihydroxy-5-[[1-(4-hydroxyphenyl)triazol-4-yl]methyl]-9-[2-(oxan-4-ylamino)ethyl]-15-oxa-3,6,9-triazabicyclo[10.2.1]pentadecane-4,7,10-trione.
| Compound Name | (1R,5R,12S)-13,14-dihydroxy-5-[[1-(4-hydroxyphenyl)triazol-4-yl]methyl]-9-[2-(oxan-4-ylamino)ethyl]-15-oxa-3,6,9-triazabicyclo[10.2.1]pentadecane-4,7,10-trione |
|---|---|
| PubChem CID | 154813662 |
| Molecular Formula | C27H37N7O8 |
| Molecular Weight | 587.63 g/mol |
| Exact Mass | 587.27 |
| IUPAC Name | (1R,5R,12S)-13,14-dihydroxy-5-[[1-(4-hydroxyphenyl)triazol-4-yl]methyl]-9-[2-(oxan-4-ylamino)ethyl]-15-oxa-3,6,9-triazabicyclo[10.2.1]pentadecane-4,7,10-trione |
| SMILES | O=C1CN(CCNC2CCOCC2)C(=O)C[C@@H]2O[C@H](CNC(=O)[C@@H](Cc3cn(-c4ccc(O)cc4)nn3)N1)C(O)C2O |
| InChI | InChI=1S/C27H37N7O8/c35-19-3-1-18(2-4-19)34-14-17(31-32-34)11-20-27(40)29-13-22-26(39)25(38)21(42-22)12-24(37)33(15-23(36)30-20)8-7-28-16-5-9-41-10-6-16/h1-4,14,16,20-22,25-26,28,35,38-39H,5-13,15H2,(H,29,40)(H,30,36)/t20-,21+,22-,25?,26?/m1/s1 |
| InChIKey | RPOUDXIJUWWSCE-XZAXVHJQSA-N |
| XLogP | -2.39 |
| TPSA | 200.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.63 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |