C25H29N5O4 — CID 58488874
9H-fluoren-9-ylmethyl (2S,5R)-5-acetyl-2-[3-(diaminomethylideneamino)propyl]-3-oxopiperazine-1-carboxylate (PubChem CID 58488874) has the molecular formula C25H29N5O4 and a molecular weight of 463.54 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (2S,5R)-5-acetyl-2-[3-(diaminomethylideneamino)propyl]-3-oxopiperazine-1-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl (2S,5R)-5-acetyl-2-[3-(diaminomethylideneamino)propyl]-3-oxopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 58488874 |
| Molecular Formula | C25H29N5O4 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (2S,5R)-5-acetyl-2-[3-(diaminomethylideneamino)propyl]-3-oxopiperazine-1-carboxylate |
| SMILES | CC(=O)[C@H]1CN(C(=O)OCC2c3ccccc3-c3ccccc32)[C@@H](CCCN=C(N)N)C(=O)N1 |
| InChI | InChI=1S/C25H29N5O4/c1-15(31)21-13-30(22(23(32)29-21)11-6-12-28-24(26)27)25(33)34-14-20-18-9-4-2-7-16(18)17-8-3-5-10-19(17)20/h2-5,7-10,20-22H,6,11-14H2,1H3,(H,29,32)(H4,26,27,28)/t21-,22+/m1/s1 |
| InChIKey | QUICGLNNPAUKED-YADHBBJMSA-N |
| XLogP | 1.75 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|