C24H29N5O5 — CID 143552679
4-(9H-fluoren-9-ylmethoxycarbonyl)-6-oxopiperazine-2-carboxylic acid;2-propylguanidine (PubChem CID 143552679) has the molecular formula C24H29N5O5 and a molecular weight of 467.53 g/mol. Its IUPAC name is 4-(9H-fluoren-9-ylmethoxycarbonyl)-6-oxopiperazine-2-carboxylic acid;2-propylguanidine.
| Compound Name | 4-(9H-fluoren-9-ylmethoxycarbonyl)-6-oxopiperazine-2-carboxylic acid;2-propylguanidine |
|---|---|
| PubChem CID | 143552679 |
| Molecular Formula | C24H29N5O5 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 4-(9H-fluoren-9-ylmethoxycarbonyl)-6-oxopiperazine-2-carboxylic acid;2-propylguanidine |
| SMILES | CCCN=C(N)N.O=C1CN(C(=O)OCC2c3ccccc3-c3ccccc32)CC(C(=O)O)N1 |
| InChI | InChI=1S/C20H18N2O5.C4H11N3/c23-18-10-22(9-17(21-18)19(24)25)20(26)27-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16;1-2-3-7-4(5)6/h1-8,16-17H,9-11H2,(H,21,23)(H,24,25);2-3H2,1H3,(H4,5,6,7) |
| InChIKey | CEHVYGIRVISAFY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 160.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|