C22H36N8O9 — CID 101460710
2-[7-[3-(diaminomethylideneamino)propyl]-10-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2,5,8,11,14-pentaoxo-1,4,7,10,13-pentazacyclopentadec-1-yl]acetic acid (PubChem CID 101460710) has the molecular formula C22H36N8O9 and a molecular weight of 556.58 g/mol. Its IUPAC name is 2-[7-[3-(diaminomethylideneamino)propyl]-10-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2,5,8,11,14-pentaoxo-1,4,7,10,13-pentazacyclopentadec-1-yl]acetic acid.
| Compound Name | 2-[7-[3-(diaminomethylideneamino)propyl]-10-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2,5,8,11,14-pentaoxo-1,4,7,10,13-pentazacyclopentadec-1-yl]acetic acid |
|---|---|
| PubChem CID | 101460710 |
| Molecular Formula | C22H36N8O9 |
| Molecular Weight | 556.58 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | 2-[7-[3-(diaminomethylideneamino)propyl]-10-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2,5,8,11,14-pentaoxo-1,4,7,10,13-pentazacyclopentadec-1-yl]acetic acid |
| SMILES | CC(C)(C)OC(=O)CN1CC(=O)N(CCCN=C(N)N)CC(=O)NCC(=O)N(CC(=O)O)CC(=O)NCC1=O |
| InChI | InChI=1S/C22H36N8O9/c1-22(2,3)39-20(38)13-30-11-18(35)28(6-4-5-25-21(23)24)9-14(31)26-7-16(33)29(12-19(36)37)10-15(32)27-8-17(30)34/h4-13H2,1-3H3,(H,26,31)(H,27,32)(H,36,37)(H4,23,24,25) |
| InChIKey | KUNYGLUBFMCFII-UHFFFAOYSA-N |
| XLogP | -4.19 |
| TPSA | 247.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.58 |
| LogP ≤ 5 | -4.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|