C9H18N2O2 — CID 165138491
ethane;1-propylpiperazine-2,5-dione (PubChem CID 165138491) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is ethane;1-propylpiperazine-2,5-dione.
| Compound Name | ethane;1-propylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 165138491 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | ethane;1-propylpiperazine-2,5-dione |
| SMILES | CC.CCCN1CC(=O)NCC1=O |
| InChI | InChI=1S/C7H12N2O2.C2H6/c1-2-3-9-5-6(10)8-4-7(9)11;1-2/h2-5H2,1H3,(H,8,10);1-2H3 |
| InChIKey | JOAFQNVLBLELPZ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |