C10H18N2O4 — CID 103184626
1-[2-(3-methoxypropoxy)ethyl]piperazine-2,5-dione (PubChem CID 103184626) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is 1-[2-(3-methoxypropoxy)ethyl]piperazine-2,5-dione.
| Compound Name | 1-[2-(3-methoxypropoxy)ethyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 103184626 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 1-[2-(3-methoxypropoxy)ethyl]piperazine-2,5-dione |
| SMILES | COCCCOCCN1CC(=O)NCC1=O |
| InChI | InChI=1S/C10H18N2O4/c1-15-4-2-5-16-6-3-12-8-9(13)11-7-10(12)14/h2-8H2,1H3,(H,11,13) |
| InChIKey | NSCMYJUSXUWKOP-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|