About 1-(2-butoxyethyl)-1,4-diazepane-2,5-dione
1-(2-butoxyethyl)-1,4-diazepane-2,5-dione (PubChem CID 64882011) has the molecular formula C11H20N2O3
and a molecular weight of 228.29 g/mol. Its IUPAC name is 1-(2-butoxyethyl)-1,4-diazepane-2,5-dione.
Molecular Properties
| Compound Name | 1-(2-butoxyethyl)-1,4-diazepane-2,5-dione |
| PubChem CID | 64882011 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 1-(2-butoxyethyl)-1,4-diazepane-2,5-dione |
| SMILES | CCCCOCCN1CCC(=O)NCC1=O |
| InChI | InChI=1S/C11H20N2O3/c1-2-3-7-16-8-6-13-5-4-10(14)12-9-11(13)15/h2-9H2,1H3,(H,12,14) |
| InChIKey | CNZOQFJIWWYMGP-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-butoxyethyl)-1,4-diazepane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-butoxyethyl)-1,4-diazepane-2,5-dione?
The IUPAC name of 1-(2-butoxyethyl)-1,4-diazepane-2,5-dione (CID 64882011) is 1-(2-butoxyethyl)-1,4-diazepane-2,5-dione.
What is the SMILES notation for 1-(2-butoxyethyl)-1,4-diazepane-2,5-dione?
The canonical SMILES for 1-(2-butoxyethyl)-1,4-diazepane-2,5-dione is CCCCOCCN1CCC(=O)NCC1=O.
What is the InChIKey of 1-(2-butoxyethyl)-1,4-diazepane-2,5-dione?
The InChIKey is CNZOQFJIWWYMGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O3/c1-2-3-7-16-8-6-13-5-4-10(14)12-9-11(13)15/h2-9H2,1H3,(H,12,14).
What are the key properties of 1-(2-butoxyethyl)-1,4-diazepane-2,5-dione?
1-(2-butoxyethyl)-1,4-diazepane-2,5-dione has a molecular weight of 228.29 g/mol, XLogP of 0.15, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-butoxyethyl)-1,4-diazepane-2,5-dione is sourced from PubChem (CID 64882011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).