C9H16N2O3 — CID 103935917
3-(2-butoxyethyl)imidazolidine-2,4-dione (PubChem CID 103935917) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is 3-(2-butoxyethyl)imidazolidine-2,4-dione.
| Compound Name | 3-(2-butoxyethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 103935917 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 3-(2-butoxyethyl)imidazolidine-2,4-dione |
| SMILES | CCCCOCCN1C(=O)CNC1=O |
| InChI | InChI=1S/C9H16N2O3/c1-2-3-5-14-6-4-11-8(12)7-10-9(11)13/h2-7H2,1H3,(H,10,13) |
| InChIKey | FSXIQHDBTXIGMV-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|