C14H22N2O4 — CID 115947657
9-(2-butoxyethyl)-7,9-diazaspiro[4.5]decane-6,8,10-trione (PubChem CID 115947657) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is 9-(2-butoxyethyl)-7,9-diazaspiro[4.5]decane-6,8,10-trione.
| Compound Name | 9-(2-butoxyethyl)-7,9-diazaspiro[4.5]decane-6,8,10-trione |
|---|---|
| PubChem CID | 115947657 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 9-(2-butoxyethyl)-7,9-diazaspiro[4.5]decane-6,8,10-trione |
| SMILES | CCCCOCCN1C(=O)NC(=O)C2(CCCC2)C1=O |
| InChI | InChI=1S/C14H22N2O4/c1-2-3-9-20-10-8-16-12(18)14(6-4-5-7-14)11(17)15-13(16)19/h2-10H2,1H3,(H,15,17,19) |
| InChIKey | XVEGMOYRXMGMDR-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|