C10H14N2O5S — CID 112599614
8-(2-methylsulfonylethyl)-6,8-diazaspiro[3.5]nonane-5,7,9-trione (PubChem CID 112599614) has the molecular formula C10H14N2O5S and a molecular weight of 274.30 g/mol. Its IUPAC name is 8-(2-methylsulfonylethyl)-6,8-diazaspiro[3.5]nonane-5,7,9-trione.
| Compound Name | 8-(2-methylsulfonylethyl)-6,8-diazaspiro[3.5]nonane-5,7,9-trione |
|---|---|
| PubChem CID | 112599614 |
| Molecular Formula | C10H14N2O5S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 8-(2-methylsulfonylethyl)-6,8-diazaspiro[3.5]nonane-5,7,9-trione |
| SMILES | CS(=O)(=O)CCN1C(=O)NC(=O)C2(CCC2)C1=O |
| InChI | InChI=1S/C10H14N2O5S/c1-18(16,17)6-5-12-8(14)10(3-2-4-10)7(13)11-9(12)15/h2-6H2,1H3,(H,11,13,15) |
| InChIKey | JGBJWWRTCDTFIN-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|