C8H17N3O2 — CID 174744496
azane;1-butylpiperazine-2,5-dione (PubChem CID 174744496) has the molecular formula C8H17N3O2 and a molecular weight of 187.24 g/mol. Its IUPAC name is azane;1-butylpiperazine-2,5-dione.
| Compound Name | azane;1-butylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 174744496 |
| Molecular Formula | C8H17N3O2 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.13 |
| IUPAC Name | azane;1-butylpiperazine-2,5-dione |
| SMILES | CCCCN1CC(=O)NCC1=O.N |
| InChI | InChI=1S/C8H14N2O2.H3N/c1-2-3-4-10-6-7(11)9-5-8(10)12;/h2-6H2,1H3,(H,9,11);1H3 |
| InChIKey | HIKJLSNGTLCHFZ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 84.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |