About azane;1-butylpiperazine-2,5-dione
azane;1-butylpiperazine-2,5-dione (PubChem CID 174744496) has the molecular formula C8H17N3O2
and a molecular weight of 187.24 g/mol. Its IUPAC name is azane;1-butylpiperazine-2,5-dione.
Molecular Properties
| Compound Name | azane;1-butylpiperazine-2,5-dione |
| PubChem CID | 174744496 |
| Molecular Formula | C8H17N3O2 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.13 |
| IUPAC Name | azane;1-butylpiperazine-2,5-dione |
| SMILES | CCCCN1CC(=O)NCC1=O.N |
| InChI | InChI=1S/C8H14N2O2.H3N/c1-2-3-4-10-6-7(11)9-5-8(10)12;/h2-6H2,1H3,(H,9,11);1H3 |
| InChIKey | HIKJLSNGTLCHFZ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 84.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;1-butylpiperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-butylpiperazine-2,5-dione?
The IUPAC name of azane;1-butylpiperazine-2,5-dione (CID 174744496) is azane;1-butylpiperazine-2,5-dione.
What is the SMILES notation for azane;1-butylpiperazine-2,5-dione?
The canonical SMILES for azane;1-butylpiperazine-2,5-dione is CCCCN1CC(=O)NCC1=O.N.
What is the InChIKey of azane;1-butylpiperazine-2,5-dione?
The InChIKey is HIKJLSNGTLCHFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2.H3N/c1-2-3-4-10-6-7(11)9-5-8(10)12;/h2-6H2,1H3,(H,9,11);1H3.
What are the key properties of azane;1-butylpiperazine-2,5-dione?
azane;1-butylpiperazine-2,5-dione has a molecular weight of 187.24 g/mol, XLogP of -0.09, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-butylpiperazine-2,5-dione is sourced from PubChem (CID 174744496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).