C10H18N2O5 — CID 113427526
1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]imidazolidine-2,4-dione (PubChem CID 113427526) has the molecular formula C10H18N2O5 and a molecular weight of 246.26 g/mol. Its IUPAC name is 1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]imidazolidine-2,4-dione.
| Compound Name | 1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 113427526 |
| Molecular Formula | C10H18N2O5 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]imidazolidine-2,4-dione |
| SMILES | COCCOCCOCCN1CC(=O)NC1=O |
| InChI | InChI=1S/C10H18N2O5/c1-15-4-5-17-7-6-16-3-2-12-8-9(13)11-10(12)14/h2-8H2,1H3,(H,11,13,14) |
| InChIKey | GTBROMUYBUQQOF-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|