C10H18N2O4 — CID 64880925
1-[2-(2-methoxyethoxy)ethyl]-3-methylpiperazine-2,5-dione (PubChem CID 64880925) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is 1-[2-(2-methoxyethoxy)ethyl]-3-methylpiperazine-2,5-dione.
| Compound Name | 1-[2-(2-methoxyethoxy)ethyl]-3-methylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 64880925 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 1-[2-(2-methoxyethoxy)ethyl]-3-methylpiperazine-2,5-dione |
| SMILES | COCCOCCN1CC(=O)NC(C)C1=O |
| InChI | InChI=1S/C10H18N2O4/c1-8-10(14)12(7-9(13)11-8)3-4-16-6-5-15-2/h8H,3-7H2,1-2H3,(H,11,13) |
| InChIKey | RYQVLGPMBCQOTE-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|