C18H34N6O4 — CID 142360233
1-[5-[2-[(Z)-3-[2-(2-methoxyethoxy)ethylamino]-4-(methylideneamino)but-3-en-2-yl]hydrazinyl]pentyl]imidazolidine-2,4-dione (PubChem CID 142360233) has the molecular formula C18H34N6O4 and a molecular weight of 398.51 g/mol. Its IUPAC name is 1-[5-[2-[(Z)-3-[2-(2-methoxyethoxy)ethylamino]-4-(methylideneamino)but-3-en-2-yl]hydrazinyl]pentyl]imidazolidine-2,4-dione.
| Compound Name | 1-[5-[2-[(Z)-3-[2-(2-methoxyethoxy)ethylamino]-4-(methylideneamino)but-3-en-2-yl]hydrazinyl]pentyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 142360233 |
| Molecular Formula | C18H34N6O4 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | 1-[5-[2-[(Z)-3-[2-(2-methoxyethoxy)ethylamino]-4-(methylideneamino)but-3-en-2-yl]hydrazinyl]pentyl]imidazolidine-2,4-dione |
| SMILES | C=N/C=C(\NCCOCCOC)C(C)NNCCCCCN1CC(=O)NC1=O |
| InChI | InChI=1S/C18H34N6O4/c1-15(16(13-19-2)20-8-10-28-12-11-27-3)23-21-7-5-4-6-9-24-14-17(25)22-18(24)26/h13,15,20-21,23H,2,4-12,14H2,1,3H3,(H,22,25,26)/b16-13- |
| InChIKey | IPIJCNDIVRZGLV-SSZFMOIBSA-N |
| XLogP | -0.01 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|