C6H9ClN2O2 — CID 118050354
1-(3-chloropropyl)imidazolidine-2,4-dione (PubChem CID 118050354) has the molecular formula C6H9ClN2O2 and a molecular weight of 176.60 g/mol. Its IUPAC name is 1-(3-chloropropyl)imidazolidine-2,4-dione.
| Compound Name | 1-(3-chloropropyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 118050354 |
| Molecular Formula | C6H9ClN2O2 |
| Molecular Weight | 176.60 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | 1-(3-chloropropyl)imidazolidine-2,4-dione |
| SMILES | O=C1CN(CCCCl)C(=O)N1 |
| InChI | InChI=1S/C6H9ClN2O2/c7-2-1-3-9-4-5(10)8-6(9)11/h1-4H2,(H,8,10,11) |
| InChIKey | IJBAJEZJOHFKBX-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.60 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|