C5H10ClN3O2 — CID 171692224
1-(2-aminoethyl)imidazolidine-2,4-dione;hydrochloride (PubChem CID 171692224) has the molecular formula C5H10ClN3O2 and a molecular weight of 179.61 g/mol. Its IUPAC name is 1-(2-aminoethyl)imidazolidine-2,4-dione;hydrochloride.
| Compound Name | 1-(2-aminoethyl)imidazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 171692224 |
| Molecular Formula | C5H10ClN3O2 |
| Molecular Weight | 179.61 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 1-(2-aminoethyl)imidazolidine-2,4-dione;hydrochloride |
| SMILES | Cl.NCCN1CC(=O)NC1=O |
| InChI | InChI=1S/C5H9N3O2.ClH/c6-1-2-8-3-4(9)7-5(8)10;/h1-3,6H2,(H,7,9,10);1H |
| InChIKey | QEKMDMUVGVWAQI-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.61 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|