C9H12N4O2 — CID 114531954
1-[2-(1-methylimidazol-2-yl)ethyl]imidazolidine-2,4-dione (PubChem CID 114531954) has the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is 1-[2-(1-methylimidazol-2-yl)ethyl]imidazolidine-2,4-dione.
| Compound Name | 1-[2-(1-methylimidazol-2-yl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 114531954 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 1-[2-(1-methylimidazol-2-yl)ethyl]imidazolidine-2,4-dione |
| SMILES | Cn1ccnc1CCN1CC(=O)NC1=O |
| InChI | InChI=1S/C9H12N4O2/c1-12-5-3-10-7(12)2-4-13-6-8(14)11-9(13)15/h3,5H,2,4,6H2,1H3,(H,11,14,15) |
| InChIKey | XCGZWPJTZPFYSY-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|