C10H14N4O2 — CID 114531283
1-[2-(1-methylimidazol-2-yl)ethyl]piperazine-2,6-dione (PubChem CID 114531283) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 1-[2-(1-methylimidazol-2-yl)ethyl]piperazine-2,6-dione.
| Compound Name | 1-[2-(1-methylimidazol-2-yl)ethyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 114531283 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 1-[2-(1-methylimidazol-2-yl)ethyl]piperazine-2,6-dione |
| SMILES | Cn1ccnc1CCN1C(=O)CNCC1=O |
| InChI | InChI=1S/C10H14N4O2/c1-13-5-3-12-8(13)2-4-14-9(15)6-11-7-10(14)16/h3,5,11H,2,4,6-7H2,1H3 |
| InChIKey | YUTVNACAIAQJKY-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|