C14H12IN3O2 — CID 114532901
5-iodo-2-[2-(1-methylimidazol-2-yl)ethyl]isoindole-1,3-dione (PubChem CID 114532901) has the molecular formula C14H12IN3O2 and a molecular weight of 381.17 g/mol. Its IUPAC name is 5-iodo-2-[2-(1-methylimidazol-2-yl)ethyl]isoindole-1,3-dione.
| Compound Name | 5-iodo-2-[2-(1-methylimidazol-2-yl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 114532901 |
| Molecular Formula | C14H12IN3O2 |
| Molecular Weight | 381.17 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | 5-iodo-2-[2-(1-methylimidazol-2-yl)ethyl]isoindole-1,3-dione |
| SMILES | Cn1ccnc1CCN1C(=O)c2ccc(I)cc2C1=O |
| InChI | InChI=1S/C14H12IN3O2/c1-17-7-5-16-12(17)4-6-18-13(19)10-3-2-9(15)8-11(10)14(18)20/h2-3,5,7-8H,4,6H2,1H3 |
| InChIKey | KULPQHRVRROCHM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.17 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|