C11H11Br2N3O — CID 114531001
3,5-dibromo-1-[2-(1-methylimidazol-2-yl)ethyl]pyridin-2-one (PubChem CID 114531001) has the molecular formula C11H11Br2N3O and a molecular weight of 361.04 g/mol. Its IUPAC name is 3,5-dibromo-1-[2-(1-methylimidazol-2-yl)ethyl]pyridin-2-one.
| Compound Name | 3,5-dibromo-1-[2-(1-methylimidazol-2-yl)ethyl]pyridin-2-one |
|---|---|
| PubChem CID | 114531001 |
| Molecular Formula | C11H11Br2N3O |
| Molecular Weight | 361.04 g/mol |
| Exact Mass | 358.93 |
| IUPAC Name | 3,5-dibromo-1-[2-(1-methylimidazol-2-yl)ethyl]pyridin-2-one |
| SMILES | Cn1ccnc1CCn1cc(Br)cc(Br)c1=O |
| InChI | InChI=1S/C11H11Br2N3O/c1-15-5-3-14-10(15)2-4-16-7-8(12)6-9(13)11(16)17/h3,5-7H,2,4H2,1H3 |
| InChIKey | VXEFBMSNBLWSCE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.04 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |