About methanamine;1-methyl-2-propylimidazole
methanamine;1-methyl-2-propylimidazole (PubChem CID 164902083) has the molecular formula C8H17N3
and a molecular weight of 155.25 g/mol. Its IUPAC name is methanamine;1-methyl-2-propylimidazole.
Molecular Properties
| Compound Name | methanamine;1-methyl-2-propylimidazole |
| PubChem CID | 164902083 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.25 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | methanamine;1-methyl-2-propylimidazole |
| SMILES | CCCc1nccn1C.CN |
| InChI | InChI=1S/C7H12N2.CH5N/c1-3-4-7-8-5-6-9(7)2;1-2/h5-6H,3-4H2,1-2H3;2H2,1H3 |
| InChIKey | FLNHBDVMRNOUQO-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.25 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methanamine;1-methyl-2-propylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;1-methyl-2-propylimidazole?
The IUPAC name of methanamine;1-methyl-2-propylimidazole (CID 164902083) is methanamine;1-methyl-2-propylimidazole.
What is the SMILES notation for methanamine;1-methyl-2-propylimidazole?
The canonical SMILES for methanamine;1-methyl-2-propylimidazole is CCCc1nccn1C.CN.
What is the InChIKey of methanamine;1-methyl-2-propylimidazole?
The InChIKey is FLNHBDVMRNOUQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2.CH5N/c1-3-4-7-8-5-6-9(7)2;1-2/h5-6H,3-4H2,1-2H3;2H2,1H3.
What are the key properties of methanamine;1-methyl-2-propylimidazole?
methanamine;1-methyl-2-propylimidazole has a molecular weight of 155.25 g/mol, XLogP of 0.95, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;1-methyl-2-propylimidazole is sourced from PubChem (CID 164902083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).