About 2-butyl-1-methylimidazole;fluoroform
2-butyl-1-methylimidazole;fluoroform (PubChem CID 162050255) has the molecular formula C9H15F3N2
and a molecular weight of 208.23 g/mol. Its IUPAC name is 2-butyl-1-methylimidazole;fluoroform.
Molecular Properties
| Compound Name | 2-butyl-1-methylimidazole;fluoroform |
| PubChem CID | 162050255 |
| Molecular Formula | C9H15F3N2 |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 2-butyl-1-methylimidazole;fluoroform |
| SMILES | CCCCc1nccn1C.FC(F)F |
| InChI | InChI=1S/C8H14N2.CHF3/c1-3-4-5-8-9-6-7-10(8)2;2-1(3)4/h6-7H,3-5H2,1-2H3;1H |
| InChIKey | YYLLBXMSPPCVRK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butyl-1-methylimidazole;fluoroform with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-1-methylimidazole;fluoroform?
The IUPAC name of 2-butyl-1-methylimidazole;fluoroform (CID 162050255) is 2-butyl-1-methylimidazole;fluoroform.
What is the SMILES notation for 2-butyl-1-methylimidazole;fluoroform?
The canonical SMILES for 2-butyl-1-methylimidazole;fluoroform is CCCCc1nccn1C.FC(F)F.
What is the InChIKey of 2-butyl-1-methylimidazole;fluoroform?
The InChIKey is YYLLBXMSPPCVRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2.CHF3/c1-3-4-5-8-9-6-7-10(8)2;2-1(3)4/h6-7H,3-5H2,1-2H3;1H.
What are the key properties of 2-butyl-1-methylimidazole;fluoroform?
2-butyl-1-methylimidazole;fluoroform has a molecular weight of 208.23 g/mol, XLogP of 2.94, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-1-methylimidazole;fluoroform is sourced from PubChem (CID 162050255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).