C11H20N2O2 — CID 103455046
1-(1-methylimidazol-2-yl)heptane-3,4-diol (PubChem CID 103455046) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is 1-(1-methylimidazol-2-yl)heptane-3,4-diol.
| Compound Name | 1-(1-methylimidazol-2-yl)heptane-3,4-diol |
|---|---|
| PubChem CID | 103455046 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 1-(1-methylimidazol-2-yl)heptane-3,4-diol |
| SMILES | CCCC(O)C(O)CCc1nccn1C |
| InChI | InChI=1S/C11H20N2O2/c1-3-4-9(14)10(15)5-6-11-12-7-8-13(11)2/h7-10,14-15H,3-6H2,1-2H3 |
| InChIKey | OIARKWRNFLYRFU-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |