C9H10N4O3 — CID 112598004
1-[(1-methylimidazol-2-yl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 112598004) has the molecular formula C9H10N4O3 and a molecular weight of 222.20 g/mol. Its IUPAC name is 1-[(1-methylimidazol-2-yl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-[(1-methylimidazol-2-yl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 112598004 |
| Molecular Formula | C9H10N4O3 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 1-[(1-methylimidazol-2-yl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | Cn1ccnc1CN1C(=O)CC(=O)NC1=O |
| InChI | InChI=1S/C9H10N4O3/c1-12-3-2-10-6(12)5-13-8(15)4-7(14)11-9(13)16/h2-3H,4-5H2,1H3,(H,11,14,16) |
| InChIKey | OYXDUUCDXAWIOC-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|